EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20FN3O4 |
| Net Charge | 0 |
| Average Mass | 361.373 |
| Monoisotopic Mass | 361.14378 |
| SMILES | C[C@H]1COc2c(N3CCN(C)CC3)c(F)cc3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/t10-/m0/s1 |
| InChIKey | GSDSWSVVBLHKDQ-JTQLQIEISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000118) | PubMed (17549677) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antibacterial drug A drug used to treat or prevent bacterial infections. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| levofloxacin (CHEBI:63598) has role antibacterial drug (CHEBI:36047) |
| levofloxacin (CHEBI:63598) has role DNA synthesis inhibitor (CHEBI:59517) |
| levofloxacin (CHEBI:63598) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| levofloxacin (CHEBI:63598) has role topoisomerase IV inhibitor (CHEBI:53559) |
| levofloxacin (CHEBI:63598) is a 9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid (CHEBI:194135) |
| levofloxacin (CHEBI:63598) is a fluoroquinolone antibiotic (CHEBI:87211) |
| levofloxacin (CHEBI:63598) is a quinolone antibiotic (CHEBI:86324) |
| levofloxacin (CHEBI:63598) is conjugate acid of levofloxacin(1−) (CHEBI:231553) |
| levofloxacin (CHEBI:63598) is enantiomer of dextrofloxacin (CHEBI:46577) |
| Incoming Relation(s) |
| ofloxacin (CHEBI:7731) has part levofloxacin (CHEBI:63598) |
| levofloxacin(1−) (CHEBI:231553) is conjugate base of levofloxacin (CHEBI:63598) |
| dextrofloxacin (CHEBI:46577) is enantiomer of levofloxacin (CHEBI:63598) |
| IUPAC Name |
|---|
| (3S)-9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid |
| INNs | Source |
|---|---|
| levofloxacine | ChemIDplus |
| levofloxacino | ChemIDplus |
| levofloxacinum | ChemIDplus |
| levofloxacin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Ofloxacin S-(-)-form | KEGG COMPOUND |
| (S)-ofloxacin | ChemIDplus |
| (-)-Ofloxacin | ChemIDplus |
| (S)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-7H-pyrido(1,2,3-de)-1,4-benzoxazine-6-carboxylic acid | ChemIDplus |
| (3S)-(-)-9-fluoro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de][1,4]benzoxazine-6-carboxylic acid | ChEBI |
| (S)-(-)-9-fluoro-3-methyl-10-(4-methyl-1-piperazinyl)-7-oxo-2,3-dihydro-7H-pyrido[1,2,3-de][1,4]benzooxazine-6-carboxylic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C07660 | KEGG COMPOUND |
| Levofloxacin | Wikipedia |
| D08120 | KEGG DRUG |
| HMDB0001929 | HMDB |
| DB01137 | DrugBank |
| LSM-5270 | LINCS |
| 1569 | DrugCentral |
| 1899 | VSDB |
| LFX | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5385660 | Reaxys |
| CAS:100986-85-4 | KEGG COMPOUND |
| CAS:100986-85-4 | ChemIDplus |
| Citations |
|---|