EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:46577 - dextrofloxacin
| Formula | C18H20FN3O4 |
| Net Charge | 0 |
| Average Mass | 361.373 |
| Monoisotopic Mass | 361.14378 |
| SMILES | C[C@@H]1COc2c(N3CCN(C)CC3)c(F)cc3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/t10-/m1/s1 |
| InChIKey | GSDSWSVVBLHKDQ-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextrofloxacin (CHEBI:46577) has role antibacterial drug (CHEBI:36047) |
| dextrofloxacin (CHEBI:46577) has role DNA synthesis inhibitor (CHEBI:59517) |
| dextrofloxacin (CHEBI:46577) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| dextrofloxacin (CHEBI:46577) has role topoisomerase IV inhibitor (CHEBI:53559) |
| dextrofloxacin (CHEBI:46577) is a 9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid (CHEBI:194135) |
| dextrofloxacin (CHEBI:46577) is a fluoroquinolone antibiotic (CHEBI:87211) |
| dextrofloxacin (CHEBI:46577) is a quinolone antibiotic (CHEBI:86324) |
| dextrofloxacin (CHEBI:46577) is enantiomer of levofloxacin (CHEBI:63598) |
| Incoming Relation(s) |
| ofloxacin (CHEBI:7731) has part dextrofloxacin (CHEBI:46577) |
| levofloxacin (CHEBI:63598) is enantiomer of dextrofloxacin (CHEBI:46577) |
| IUPAC Name |
|---|
| (3R)-9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid |
| Synonyms | Source |
|---|---|
| dextrofloxacine | PDBeChem |
| R-ofloxacin | ChemIDplus |
| (R)-ofloxacin | ChEBI |
| D-ofloxacin | ChemIDplus |
| DR 3354 | ChEBI |
| DR-3354 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:100986-86-5 | ChemIDplus |
| Citations |
|---|