EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:46577 - dextrofloxacin
| Formula | C18H20FN3O4 |
| Net Charge | 0 |
| Average Mass | 361.373 |
| Monoisotopic Mass | 361.14378 |
| SMILES | C[C@@H]1COc2c(N3CCN(C)CC3)c(F)cc3c(=O)c(C(=O)O)cn1c23 |
| InChI | InChI=1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/t10-/m1/s1 |
| InChIKey | GSDSWSVVBLHKDQ-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antibacterial drug A drug used to treat or prevent bacterial infections. EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase (ATP-hydrolysing), EC 5.99.1.3 (also known as topoisomerase II and as DNA gyrase), which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dextrofloxacin (CHEBI:46577) has role antibacterial drug (CHEBI:36047) |
| dextrofloxacin (CHEBI:46577) has role DNA synthesis inhibitor (CHEBI:59517) |
| dextrofloxacin (CHEBI:46577) has role EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor (CHEBI:50750) |
| dextrofloxacin (CHEBI:46577) has role topoisomerase IV inhibitor (CHEBI:53559) |
| dextrofloxacin (CHEBI:46577) is a 9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid (CHEBI:194135) |
| dextrofloxacin (CHEBI:46577) is a fluoroquinolone antibiotic (CHEBI:87211) |
| dextrofloxacin (CHEBI:46577) is a quinolone antibiotic (CHEBI:86324) |
| dextrofloxacin (CHEBI:46577) is enantiomer of levofloxacin (CHEBI:63598) |
| Incoming Relation(s) |
| ofloxacin (CHEBI:7731) has part dextrofloxacin (CHEBI:46577) |
| levofloxacin (CHEBI:63598) is enantiomer of dextrofloxacin (CHEBI:46577) |
| IUPAC Name |
|---|
| (3R)-9-fluoro-3-methyl-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid |
| Synonyms | Source |
|---|---|
| dextrofloxacine | PDBeChem |
| DR 3354 | ChEBI |
| DR-3354 | ChEBI |
| DR3354 | ChEBI |
| (R)-(+)-ofloxacin | ChEBI |
| (R)-ofloxacin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:100986-86-5 | ChemIDplus |
| Citations |
|---|