EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO3 |
| Net Charge | 0 |
| Average Mass | 173.212 |
| Monoisotopic Mass | 173.10519 |
| SMILES | CCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-2-3-4-5-7(10)9-6-8(11)12/h2-6H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | UPCKIPHSXMXJOX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hexanoylglycine (CHEBI:64390) has role metabolite (CHEBI:25212) |
| N-hexanoylglycine (CHEBI:64390) is a N-acylglycine (CHEBI:16180) |
| N-hexanoylglycine (CHEBI:64390) is conjugate acid of N-hexanoylglycinate (CHEBI:133580) |
| Incoming Relation(s) |
| N-hexanoylglycinate (CHEBI:133580) is conjugate base of N-hexanoylglycine (CHEBI:64390) |
| IUPAC Name |
|---|
| N-hexanoylglycine |
| Synonyms | Source |
|---|---|
| N-caproylglycine | ChemIDplus |
| Hexanoylglycine | ChemIDplus |
| Caproylglycine | HMDB |
| n-Hexanoylglycine | HMDB |
| N-(1-oxohexyl)glycine | HMDB |
| Citations |
|---|