EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14NO3 |
| Net Charge | -1 |
| Average Mass | 172.204 |
| Monoisotopic Mass | 172.09792 |
| SMILES | CCCCCC(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C8H15NO3/c1-2-3-4-5-7(10)9-6-8(11)12/h2-6H2,1H3,(H,9,10)(H,11,12)/p-1 |
| InChIKey | UPCKIPHSXMXJOX-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hexanoylglycinate (CHEBI:133580) has role metabolite (CHEBI:25212) |
| N-hexanoylglycinate (CHEBI:133580) is a N-acylglycinate (CHEBI:57670) |
| N-hexanoylglycinate (CHEBI:133580) is a monocarboxylic acid anion (CHEBI:35757) |
| N-hexanoylglycinate (CHEBI:133580) is conjugate base of N-hexanoylglycine (CHEBI:64390) |
| Incoming Relation(s) |
| N-hexanoylglycine (CHEBI:64390) is conjugate acid of N-hexanoylglycinate (CHEBI:133580) |
| IUPAC Name |
|---|
| (hexanoylamino)acetate |
| Synonyms | Source |
|---|---|
| N-caproylglycinate | ChEBI |
| N-hexanoylglycine(1−) | ChEBI |
| N-hexanoylglycine anion | ChEBI |
| UniProt Name | Source |
|---|---|
| N-hexanoylglycine | UniProt |