EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2 |
| Net Charge | 0 |
| Average Mass | 145.202 |
| Monoisotopic Mass | 145.11028 |
| SMILES | CCCCCC(N)C(=O)O |
| InChI | InChI=1S/C7H15NO2/c1-2-3-4-5-6(8)7(9)10/h6H,2-5,8H2,1H3,(H,9,10) |
| InChIKey | RDFMDVXONNIGBC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminoheptanoic acid (CHEBI:64304) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-aminoheptanoic acid (CHEBI:64304) is tautomer of 2-aminoheptanoic acid zwitterion (CHEBI:133223) |
| Incoming Relation(s) |
| L-2-aminoheptanoic acid (CHEBI:40682) is a 2-aminoheptanoic acid (CHEBI:64304) |
| 2-aminoheptanoic acid zwitterion (CHEBI:133223) is tautomer of 2-aminoheptanoic acid (CHEBI:64304) |
| IUPAC Name |
|---|
| 2-aminoheptanoic acid |
| Synonyms | Source |
|---|---|
| 2-aminoenanthic acid | ChEBI |
| Ahe | ChEBI |
| α-aminoenanthic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722015 | Reaxys |
| Citations |
|---|