EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO2 |
| Net Charge | 0 |
| Average Mass | 145.202 |
| Monoisotopic Mass | 145.11028 |
| SMILES | CCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H15NO2/c1-2-3-4-5-6(8)7(9)10/h6H,2-5,8H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | RDFMDVXONNIGBC-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-2-aminoheptanoic acid (CHEBI:40682) is a 2-aminoheptanoic acid (CHEBI:64304) |
| IUPAC Name |
|---|
| (2S)-2-aminoheptanoic acid |
| Synonyms | Source |
|---|---|
| Ahe | ChEBI |
| homonorleucine | ChEBI |
| L-Homonorleucine | LIPID MAPS |
| (S)-2-Aminoheptanoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| AHP | PDBeChem |
| LMFA01100014 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1722017 | Reaxys |