EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20O7P2 |
| Net Charge | 0 |
| Average Mass | 314.211 |
| Monoisotopic Mass | 314.06843 |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](OP(=O)(O)OP(=O)(O)O)C2 |
| InChI | InChI=1S/C10H20O7P2/c1-9(2)7-4-5-10(9,3)8(6-7)16-19(14,15)17-18(11,12)13/h7-8H,4-6H2,1-3H3,(H,14,15)(H2,11,12,13)/t7-,8+,10+/m0/s1 |
| InChIKey | VZPAJODTZAAANV-QXFUBDJGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-bornyl diphosphate (CHEBI:64298) has functional parent (−)-borneol (CHEBI:15394) |
| (−)-bornyl diphosphate (CHEBI:64298) is a bornane monoterpenoid (CHEBI:22912) |
| (−)-bornyl diphosphate (CHEBI:64298) is a monoterpenyl phosphate (CHEBI:25412) |
| (−)-bornyl diphosphate (CHEBI:64298) is conjugate acid of (−)-bornyl diphosphate(3−) (CHEBI:64285) |
| (−)-bornyl diphosphate (CHEBI:64298) is enantiomer of (+)-bornyl diphosphate (CHEBI:15395) |
| Incoming Relation(s) |
| (−)-bornyl diphosphate(3−) (CHEBI:64285) is conjugate base of (−)-bornyl diphosphate (CHEBI:64298) |
| (+)-bornyl diphosphate (CHEBI:15395) is enantiomer of (−)-bornyl diphosphate (CHEBI:64298) |
| IUPAC Name |
|---|
| (1S,2R,4S)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl trihydrogen diphosphate |
| Synonym | Source |
|---|---|
| (−)-bornyl pyrophosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8858542 | Reaxys |
| Citations |
|---|