EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15394 - (−)-borneol
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](O)C2 |
| InChI | InChI=1S/C10H18O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8+,10+/m0/s1 |
| InChIKey | DTGKSKDOIYIVQL-QXFUBDJGSA-N |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-borneol (CHEBI:15394) is a borneol (CHEBI:28093) |
| (−)-borneol (CHEBI:15394) is enantiomer of (+)-borneol (CHEBI:15393) |
| Incoming Relation(s) |
| (−)-bornyl diphosphate (CHEBI:64298) has functional parent (−)-borneol (CHEBI:15394) |
| tschimganine (CHEBI:142517) has functional parent (−)-borneol (CHEBI:15394) |
| β-hibitakanine (CHEBI:142524) has functional parent (−)-borneol (CHEBI:15394) |
| (+)-borneol (CHEBI:15393) is enantiomer of (−)-borneol (CHEBI:15394) |
| IUPAC Name |
|---|
| (1S,2R,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| Synonyms | Source |
|---|---|
| (-)-Borneol | KEGG COMPOUND |
| L-Borneol | KEGG COMPOUND |
| (1S,2R,4S)-(-)-Borneol | KEGG COMPOUND |
| (1S-endo)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol | NIST Chemistry WebBook |
| (1S,2R,4S)-(−)-borneol | NIST Chemistry WebBook |
| L-borneol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (1S,2R,4S)-borneol | UniProt |