EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18N5O6 |
| Net Charge | -1 |
| Average Mass | 412.382 |
| Monoisotopic Mass | 412.12626 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CCC(=O)c2cccc(C(=O)[O-])c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19N5O6/c20-16-13-17(22-7-21-16)24(8-23-13)18-15(27)14(26)12(30-18)5-4-11(25)9-2-1-3-10(6-9)19(28)29/h1-3,6-8,12,14-15,18,26-27H,4-5H2,(H,28,29)(H2,20,21,22)/p-1/t12-,14-,15-,18-/m1/s1 |
| InChIKey | JSTYUEOJPRFLHR-SCFUHWHPSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminodeoxyfutalosinate (CHEBI:64286) is a 5-oxo monocarboxylic acid anion (CHEBI:35975) |
| aminodeoxyfutalosinate (CHEBI:64286) is conjugate base of aminodeoxyfutalosine (CHEBI:64260) |
| Incoming Relation(s) |
| aminodeoxyfutalosine (CHEBI:64260) is conjugate acid of aminodeoxyfutalosinate (CHEBI:64286) |
| IUPAC Name |
|---|
| 3-{3-[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]propanoyl}benzoate |
| Synonyms | Source |
|---|---|
| aminodeoxyfutalosinate anion | ChEBI |
| aminodeoxyfutalosinate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-amino-6-deoxyfutalosine | UniProt |