EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N5O6 |
| Net Charge | 0 |
| Average Mass | 413.390 |
| Monoisotopic Mass | 413.13353 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CCC(=O)c2cccc(C(=O)O)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H19N5O6/c20-16-13-17(22-7-21-16)24(8-23-13)18-15(27)14(26)12(30-18)5-4-11(25)9-2-1-3-10(6-9)19(28)29/h1-3,6-8,12,14-15,18,26-27H,4-5H2,(H,28,29)(H2,20,21,22)/t12-,14-,15-,18-/m1/s1 |
| InChIKey | JSTYUEOJPRFLHR-SCFUHWHPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminodeoxyfutalosine (CHEBI:64260) is a adenosines (CHEBI:22260) |
| aminodeoxyfutalosine (CHEBI:64260) is a benzoic acids (CHEBI:22723) |
| aminodeoxyfutalosine (CHEBI:64260) is conjugate acid of aminodeoxyfutalosinate (CHEBI:64286) |
| Incoming Relation(s) |
| aminodeoxyfutalosinate (CHEBI:64286) is conjugate base of aminodeoxyfutalosine (CHEBI:64260) |
| IUPAC Name |
|---|
| 3-{3-[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl]propanoyl}benzoic acid |
| Synonym | Source |
|---|---|
| AFL | SUBMITTER |
| Citations |
|---|