EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C59H84N16O12 |
| Net Charge | 0 |
| Average Mass | 1209.421 |
| Monoisotopic Mass | 1208.64546 |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C59H84N16O12/c1-6-63-57(86)48-14-10-22-75(48)58(87)41(13-9-21-64-59(60)61)68-51(80)42(23-32(2)3)69-52(81)43(24-33(4)5)70-53(82)44(25-34-15-17-37(77)18-16-34)71-56(85)47(30-76)74-54(83)45(26-35-28-65-39-12-8-7-11-38(35)39)72-55(84)46(27-36-29-62-31-66-36)73-50(79)40-19-20-49(78)67-40/h7-8,11-12,15-18,28-29,31-33,40-48,65,76-77H,6,9-10,13-14,19-27,30H2,1-5H3,(H,62,66)(H,63,86)(H,67,78)(H,68,80)(H,69,81)(H,70,82)(H,71,85)(H,72,84)(H,73,79)(H,74,83)(H4,60,61,64)/t40-,41-,42-,43+,44-,45-,46-,47-,48-/m0/s1 |
| InChIKey | GFIJNRVAKGFPGQ-LIJARHBVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. |
| Applications: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leuprolide (CHEBI:6427) has role anti-estrogen (CHEBI:50751) |
| leuprolide (CHEBI:6427) has role antineoplastic agent (CHEBI:35610) |
| leuprolide (CHEBI:6427) has role gonadotropin releasing hormone agonist (CHEBI:63533) |
| leuprolide (CHEBI:6427) is a oligopeptide (CHEBI:25676) |
| Incoming Relation(s) |
| leuprolide acetate (CHEBI:63597) has part leuprolide (CHEBI:6427) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-leucyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide |
| INNs | Source |
|---|---|
| leuprorelina | ChemIDplus |
| leuprorelinum | ChemIDplus |
| leuproreline | ChemIDplus |
| Synonyms | Source |
|---|---|
| Leuprorelin | KEGG COMPOUND |
| pGlu-His-Trp-Ser-Tyr-D-Leu-Leu-Arg-Pro-NHC2H5 | ChEBI |
| (D-Leu6,des-Gly-NH210,Pro-ethylamide9)-gonadotropin-releasing hormone | ChemIDplus |
| pGlu-His-Trp-Ser-Tyr-D-Leu-Leu-Arg-Pro-NHEt | ChEBI |
| L-pyroglutamyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-leucyl-L-leucyl-L-arginyl-L-proline ethylamide | ChEBI |