EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C59H84N16O12 |
| Net Charge | 0 |
| Average Mass | 1209.421 |
| Monoisotopic Mass | 1208.64546 |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C59H84N16O12/c1-6-63-57(86)48-14-10-22-75(48)58(87)41(13-9-21-64-59(60)61)68-51(80)42(23-32(2)3)69-52(81)43(24-33(4)5)70-53(82)44(25-34-15-17-37(77)18-16-34)71-56(85)47(30-76)74-54(83)45(26-35-28-65-39-12-8-7-11-38(35)39)72-55(84)46(27-36-29-62-31-66-36)73-50(79)40-19-20-49(78)67-40/h7-8,11-12,15-18,28-29,31-33,40-48,65,76-77H,6,9-10,13-14,19-27,30H2,1-5H3,(H,62,66)(H,63,86)(H,67,78)(H,68,80)(H,69,81)(H,70,82)(H,71,85)(H,72,84)(H,73,79)(H,74,83)(H4,60,61,64)/t40-,41-,42-,43+,44-,45-,46-,47-,48-/m0/s1 |
| InChIKey | GFIJNRVAKGFPGQ-LIJARHBVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anti-obesity agent Any substance which is used to reduce or control weight. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Applications: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leuprolide (CHEBI:6427) has role analgesic (CHEBI:35480) |
| leuprolide (CHEBI:6427) has role anti-estrogen (CHEBI:50751) |
| leuprolide (CHEBI:6427) has role anti-HIV agent (CHEBI:64946) |
| leuprolide (CHEBI:6427) has role anti-obesity agent (CHEBI:74518) |
| leuprolide (CHEBI:6427) has role antineoplastic agent (CHEBI:35610) |
| leuprolide (CHEBI:6427) has role gonadotropin releasing hormone agonist (CHEBI:63533) |
| leuprolide (CHEBI:6427) is a oligopeptide (CHEBI:25676) |
| Incoming Relation(s) |
| leuprolide acetate (CHEBI:63597) has part leuprolide (CHEBI:6427) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-leucyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide |
| INNs | Source |
|---|---|
| leuprorelina | ChemIDplus |
| leuproreline | ChemIDplus |
| leuprorelinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| ABBOTT-43818 FREE BASE | ChEMBL |
| CKD-841 | ChEMBL |
| (D-Leu6,des-Gly-NH210,Pro-ethylamide9)-gonadotropin-releasing hormone | ChemIDplus |
| Leuporelin | ChEMBL |
| (-)-leuprolide | ChEMBL |
| Leuprorelin | KEGG COMPOUND |
| Citations |
|---|