EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C59H84N16O12 |
| Net Charge | 0 |
| Average Mass | 1209.421 |
| Monoisotopic Mass | 1208.64546 |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C59H84N16O12/c1-6-63-57(86)48-14-10-22-75(48)58(87)41(13-9-21-64-59(60)61)68-51(80)42(23-32(2)3)69-52(81)43(24-33(4)5)70-53(82)44(25-34-15-17-37(77)18-16-34)71-56(85)47(30-76)74-54(83)45(26-35-28-65-39-12-8-7-11-38(35)39)72-55(84)46(27-36-29-62-31-66-36)73-50(79)40-19-20-49(78)67-40/h7-8,11-12,15-18,28-29,31-33,40-48,65,76-77H,6,9-10,13-14,19-27,30H2,1-5H3,(H,62,66)(H,63,86)(H,67,78)(H,68,80)(H,69,81)(H,70,82)(H,71,85)(H,72,84)(H,73,79)(H,74,83)(H4,60,61,64)/t40-,41-,42-,43+,44-,45-,46-,47-,48-/m0/s1 |
| InChIKey | GFIJNRVAKGFPGQ-LIJARHBVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. |
| Applications: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leuprolide (CHEBI:6427) has role anti-estrogen (CHEBI:50751) |
| leuprolide (CHEBI:6427) has role antineoplastic agent (CHEBI:35610) |
| leuprolide (CHEBI:6427) has role gonadotropin releasing hormone agonist (CHEBI:63533) |
| leuprolide (CHEBI:6427) is a oligopeptide (CHEBI:25676) |
| Incoming Relation(s) |
| leuprolide acetate (CHEBI:63597) has part leuprolide (CHEBI:6427) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-leucyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide |
| INNs | Source |
|---|---|
| leuprorelina | ChemIDplus |
| leuproreline | ChemIDplus |
| leuprorelinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (D-Leu6,des-Gly-NH210,Pro-ethylamide9)-gonadotropin-releasing hormone | ChemIDplus |
| Leuprorelin | KEGG COMPOUND |
| pGlu-His-Trp-Ser-Tyr-D-Leu-Leu-Arg-Pro-NHC2H5 | ChEBI |
| pGlu-His-Trp-Ser-Tyr-D-Leu-Leu-Arg-Pro-NHEt | ChEBI |
| L-pyroglutamyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-leucyl-L-leucyl-L-arginyl-L-proline ethylamide | ChEBI |