EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2.C59H84N16O12 |
| Net Charge | 0 |
| Average Mass | 1269.473 |
| Monoisotopic Mass | 1268.66659 |
| SMILES | CC(=O)O.CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](Cc1cncn1)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C59H84N16O12.C2H4O2/c1-6-63-57(86)48-14-10-22-75(48)58(87)41(13-9-21-64-59(60)61)68-51(80)42(23-32(2)3)69-52(81)43(24-33(4)5)70-53(82)44(25-34-15-17-37(77)18-16-34)71-56(85)47(30-76)74-54(83)45(26-35-28-65-39-12-8-7-11-38(35)39)72-55(84)46(27-36-29-62-31-66-36)73-50(79)40-19-20-49(78)67-40;1-2(3)4/h7-8,11-12,15-18,28-29,31-33,40-48,65,76-77H,6,9-10,13-14,19-27,30H2,1-5H3,(H,62,66)(H,63,86)(H,67,78)(H,68,80)(H,69,81)(H,70,82)(H,71,85)(H,72,84)(H,73,79)(H,74,83)(H4,60,61,64);1H3,(H,3,4)/t40-,41-,42-,43+,44-,45-,46-,47-,48-;/m0./s1 |
| InChIKey | RGLRXNKKBLIBQS-XNHQSDQCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. gonadotropin releasing hormone agonist Any drug which binds to gonadotropin-releasing hormone receptors and triggers a response. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leuprolide acetate (CHEBI:63597) has part leuprolide (CHEBI:6427) |
| leuprolide acetate (CHEBI:63597) has role anti-obesity agent (CHEBI:74518) |
| leuprolide acetate (CHEBI:63597) has role antidepressant (CHEBI:35469) |
| leuprolide acetate (CHEBI:63597) has role antihypertensive agent (CHEBI:35674) |
| leuprolide acetate (CHEBI:63597) has role antineoplastic agent (CHEBI:35610) |
| leuprolide acetate (CHEBI:63597) has role gonadotropin releasing hormone agonist (CHEBI:63533) |
| leuprolide acetate (CHEBI:63597) is a acetate salt (CHEBI:59230) |
| IUPAC Name |
|---|
| 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-leucyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide—acetic acid (1/1) |
| Synonyms | Source |
|---|---|
| 5-Oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tryosyl-D-leucyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide monoacetate | ChemIDplus |
| A-43818 | ChEMBL |
| ABBOTT-43818 | ChEMBL |
| Carcinil | ChEMBL |
| Fensolvi | ChEMBL |
| Leuplin | ChEMBL |
| Brand Names | Source |
|---|---|
| Eligard kit | ChEMBL |
| Enantone | ChEBI |
| Fensolvi kit | ChEMBL |
| Lupron | KEGG COMPOUND |
| Lupron depot | ChEMBL |
| Lupron depot ped | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00989 | KEGG DRUG |
| DB00007 | DrugBank |
| Leuprorelin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5570787 | Reaxys |
| CAS:74381-53-6 | ChemIDplus |
| CAS:74381-53-6 | KEGG DRUG |
| Citations |
|---|