EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38N6O4 |
| Net Charge | 0 |
| Average Mass | 426.562 |
| Monoisotopic Mass | 426.29545 |
| SMILES | [H]C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C20H38N6O4/c1-12(2)9-16(24-14(5)28)19(30)26-17(10-13(3)4)18(29)25-15(11-27)7-6-8-23-20(21)22/h11-13,15-17H,6-10H2,1-5H3,(H,24,28)(H,25,29)(H,26,30)(H4,21,22,23)/t15-,16-,17-/m0/s1 |
| InChIKey | GDBQQVLCIARPGH-ULQDDVLXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces exfoliatus (ncbitaxon:1905) | - | PubMed (9531495) | Strain: SMF13 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | calpain inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of any calpain. serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. cathepsin B inhibitor A cysteine protease inhibitor which inhibits cathepsin B (EC 3.4.22.1). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 3.4.21.4 (trypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of trypsin (EC 3.4.21.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leupeptin (CHEBI:6426) has role bacterial metabolite (CHEBI:76969) |
| leupeptin (CHEBI:6426) has role calpain inhibitor (CHEBI:82824) |
| leupeptin (CHEBI:6426) has role cathepsin B inhibitor (CHEBI:64932) |
| leupeptin (CHEBI:6426) has role EC 3.4.21.4 (trypsin) inhibitor (CHEBI:76940) |
| leupeptin (CHEBI:6426) has role serine protease inhibitor (CHEBI:64926) |
| leupeptin (CHEBI:6426) is a aldehyde (CHEBI:17478) |
| leupeptin (CHEBI:6426) is a tripeptide (CHEBI:47923) |
| leupeptin (CHEBI:6426) is conjugate base of leupeptin(1+) (CHEBI:192489) |
| Incoming Relation(s) |
| leupeptin(1+) (CHEBI:192489) is conjugate acid of leupeptin (CHEBI:6426) |
| IUPAC Name |
|---|
| N-acetyl-L-leucyl-N-[(2S)-5-carbamimidamido-1-oxopentan-2-yl]-L-leucinamide |
| Synonyms | Source |
|---|---|
| acetyl-L-leucyl-L-leucyl-L-argininal | ChEBI |
| Ac-Leu-Leu-Arg-H | ChEBI |
| Ac-Leu-Leu-argininal | ChEBI |
| Ac-LLR-H | ChEBI |
| Ac-L-Leu-L-Leu-L-Arg-H | ChEBI |
| N-acetyl-leucylleucylargininal | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01591 | KEGG COMPOUND |
| HMDB0254042 | HMDB |
| Leupeptin | Wikipedia |
| LEUPEPTIN | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2402463 | Reaxys |
| Reaxys:24140639 | Reaxys |
| CAS:55123-66-5 | ChemIDplus |
| Citations |
|---|