EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39N6O4 |
| Net Charge | +1 |
| Average Mass | 427.570 |
| Monoisotopic Mass | 427.30273 |
| SMILES | [H]C(=O)[C@H](CCCNC(N)=[NH2+])NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(C)=O |
| InChI | InChI=1S/C20H38N6O4/c1-12(2)9-16(24-14(5)28)19(30)26-17(10-13(3)4)18(29)25-15(11-27)7-6-8-23-20(21)22/h11-13,15-17H,6-10H2,1-5H3,(H,24,28)(H,25,29)(H,26,30)(H4,21,22,23)/p+1/t15-,16-,17-/m0/s1 |
| InChIKey | GDBQQVLCIARPGH-ULQDDVLXSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leupeptin(1+) (CHEBI:192489) is a guanidinium ion (CHEBI:60251) |
| leupeptin(1+) (CHEBI:192489) is conjugate acid of leupeptin (CHEBI:6426) |
| Incoming Relation(s) |
| leupeptin (CHEBI:6426) is conjugate base of leupeptin(1+) (CHEBI:192489) |
| IUPAC Name |
|---|
| N-acetyl-L-leucyl-N-[(2S)-5-{[amino(iminio)methyl]amino}-1-oxopentan-2-yl]-L-leucinamide |
| Synonym | Source |
|---|---|
| leupeptin cation | ChEBI |
| UniProt Name | Source |
|---|---|
| leupeptin | UniProt |