EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | C=C(C)[C@H](CC[C@@H](C)O)CC(=O)O |
| InChI | InChI=1S/C10H18O3/c1-7(2)9(6-10(12)13)5-4-8(3)11/h8-9,11H,1,4-6H2,2-3H3,(H,12,13)/t8-,9-/m1/s1 |
| InChIKey | NQYDFAGFKCSWGI-RKDXNWHRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,6R)-6-hydroxy-3-isopropenylheptanoic acid (CHEBI:64247) is a 6-hydroxy-3-isopropenylheptanoic acid (CHEBI:50452) |
| (3R,6R)-6-hydroxy-3-isopropenylheptanoic acid (CHEBI:64247) is conjugate acid of (3R,6R)-6-hydroxy-3-isopropenylheptanoate (CHEBI:64225) |
| Incoming Relation(s) |
| (3R,6R)-6-hydroxy-3-isopropenylheptanoate (CHEBI:64225) is conjugate base of (3R,6R)-6-hydroxy-3-isopropenylheptanoic acid (CHEBI:64247) |
| IUPAC Name |
|---|
| (3R,6R)-6-hydroxy-3-(prop-1-en-2-yl)heptanoic acid |