EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O3 |
| Net Charge | 0 |
| Average Mass | 186.251 |
| Monoisotopic Mass | 186.12559 |
| SMILES | C=C(C)C(CCC(C)O)CC(=O)O |
| InChI | InChI=1S/C10H18O3/c1-7(2)9(6-10(12)13)5-4-8(3)11/h8-9,11H,1,4-6H2,2-3H3,(H,12,13) |
| InChIKey | NQYDFAGFKCSWGI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxy-3-isopropenylheptanoic acid (CHEBI:50452) is a branched-chain fatty acid (CHEBI:35819) |
| 6-hydroxy-3-isopropenylheptanoic acid (CHEBI:50452) is a hydroxy fatty acid (CHEBI:24654) |
| 6-hydroxy-3-isopropenylheptanoic acid (CHEBI:50452) is a medium-chain fatty acid (CHEBI:59554) |
| 6-hydroxy-3-isopropenylheptanoic acid (CHEBI:50452) is conjugate acid of 6-hydroxy-3-isopropenylheptanoate (CHEBI:64224) |
| Incoming Relation(s) |
| (3R,6R)-6-hydroxy-3-isopropenylheptanoic acid (CHEBI:64247) is a 6-hydroxy-3-isopropenylheptanoic acid (CHEBI:50452) |
| (3S,6R)-6-hydroxy-3-isopropenylheptanoic acid (CHEBI:64249) is a 6-hydroxy-3-isopropenylheptanoic acid (CHEBI:50452) |
| 6-hydroxy-3-isopropenylheptanoate (CHEBI:64224) is conjugate base of 6-hydroxy-3-isopropenylheptanoic acid (CHEBI:50452) |
| IUPAC Name |
|---|
| 6-hydroxy-3-(prop-1-en-2-yl)heptanoic acid |
| Synonyms | Source |
|---|---|
| 6-hydroxy-3-(1-methylethenyl)heptanoic acid | IUPAC |
| 6-hydroxy-3-isopropenylenanthic acid | ChEBI |
| 6-hydroxy-3-(1-methylethenyl)enanthic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050371 | LIPID MAPS |