EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59560 - sapropterin
| Formula | C9H15N5O3 |
| Net Charge | 0 |
| Average Mass | 241.251 |
| Monoisotopic Mass | 241.11749 |
| SMILES | [H][C@]1([C@@H](O)[C@H](C)O)CNc2nc(N)nc(=O)c2N1 |
| InChI | InChI=1S/C9H15N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,4+,6-/m0/s1 |
| InChIKey | FNKQXYHWGSIFBK-RPDRRWSUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. diagnostic agent A substance administered to aid diagnosis of a disease. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. hepatoprotective agent Any compound that is able to prevent damage to the liver. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapropterin (CHEBI:59560) has role antihypertensive agent (CHEBI:35674) |
| sapropterin (CHEBI:59560) has role cardiovascular drug (CHEBI:35554) |
| sapropterin (CHEBI:59560) has role coenzyme (CHEBI:23354) |
| sapropterin (CHEBI:59560) has role cofactor (CHEBI:23357) |
| sapropterin (CHEBI:59560) has role dermatologic drug (CHEBI:50177) |
| sapropterin (CHEBI:59560) has role diagnostic agent (CHEBI:33295) |
| sapropterin (CHEBI:59560) has role hepatoprotective agent (CHEBI:62868) |
| sapropterin (CHEBI:59560) has role human metabolite (CHEBI:77746) |
| sapropterin (CHEBI:59560) has role renoprotective agent (CHEBI:231911) |
| sapropterin (CHEBI:59560) is a 5,6,7,8-tetrahydrobiopterin (CHEBI:15372) |
| Incoming Relation(s) |
| sapropterin dihydrochloride (CHEBI:32120) has part sapropterin (CHEBI:59560) |
| IUPAC Name |
|---|
| (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydropteridin-4(3H)-one |
| INNs | Source |
|---|---|
| sapropterin | ChemIDplus |
| sapropterina | ChemIDplus |
| sapropterine | WHO MedNet |
| sapropterinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Amino-6-(1,2-dihydroxypropyl)-5,6,7,8-tetrahydoro-4(1H)-pteridinone | KEGG COMPOUND |
| 5,6,7,8-Tetrahydrobiopterin | KEGG COMPOUND |
| (−)-(6R)-2-amino-6-((1R,2S)-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4(3H)-pteridinone | ChemIDplus |
| 6R-5,6,7,8-tetrahydrobiopterin | ChemIDplus |
| 6R-BH4 | ChEBI |
| 6R-L-5,6,7,8-tetrahydrobiopterin | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (6R)-L-erythro-5,6,7,8-tetrahydrobiopterin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4699705 | Reaxys |
| CAS:17528-72-2 | KEGG COMPOUND |
| CAS:27070-47-9 | ChemIDplus |
| Citations |
|---|