EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59560 - sapropterin
| Formula | C9H15N5O3 |
| Net Charge | 0 |
| Average Mass | 241.251 |
| Monoisotopic Mass | 241.11749 |
| SMILES | [H][C@]1([C@@H](O)[C@H](C)O)CNc2nc(N)nc(=O)c2N1 |
| InChI | InChI=1S/C9H15N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17)/t3-,4+,6-/m0/s1 |
| InChIKey | FNKQXYHWGSIFBK-RPDRRWSUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. prosthetic group A tightly bound, specific nonpolypeptide unit in a protein determining and involved in its biological activity. |
| Applications: | diagnostic agent A substance administered to aid diagnosis of a disease. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapropterin (CHEBI:59560) has role coenzyme (CHEBI:23354) |
| sapropterin (CHEBI:59560) has role cofactor (CHEBI:23357) |
| sapropterin (CHEBI:59560) has role diagnostic agent (CHEBI:33295) |
| sapropterin (CHEBI:59560) has role human metabolite (CHEBI:77746) |
| sapropterin (CHEBI:59560) is a 5,6,7,8-tetrahydrobiopterin (CHEBI:15372) |
| Incoming Relation(s) |
| sapropterin dihydrochloride (CHEBI:32120) has part sapropterin (CHEBI:59560) |
| IUPAC Name |
|---|
| (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydropteridin-4(3H)-one |
| INNs | Source |
|---|---|
| sapropterina | ChemIDplus |
| sapropterinum | ChemIDplus |
| sapropterin | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6R-L-5,6,7,8-tetrahydrobiopterin | ChemIDplus |
| (−)-(6R)-2-amino-6-((1R,2S)-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4(3H)-pteridinone | ChemIDplus |
| 6R-5,6,7,8-tetrahydrobiopterin | ChemIDplus |
| tetrahydrobiopterin | DrugBank |
| (6R)-L-erythro-tetrahydrobiopterin | ChEBI |
| R-THBP | ChEBI |
| UniProt Name | Source |
|---|---|
| (6R)-L-erythro-5,6,7,8-tetrahydrobiopterin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4699705 | Reaxys |
| CAS:27070-47-9 | ChemIDplus |
| CAS:17528-72-2 | KEGG COMPOUND |
| Citations |
|---|