EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N5O3.2HCl |
| Net Charge | 0 |
| Average Mass | 314.173 |
| Monoisotopic Mass | 313.07084 |
| SMILES | Cl.Cl.[H][C@]1([C@@H](O)[C@H](C)O)CNc2nc(N)nc(=O)c2N1 |
| InChI | InChI=1S/C9H15N5O3.2ClH/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7;;/h3-4,6,12,15-16H,2H2,1H3,(H4,10,11,13,14,17);2*1H/t3-,4+,6-;;/m0../s1 |
| InChIKey | RKSUYBCOVNCALL-NTVURLEBSA-N |
| Roles Classification |
|---|
| Biological Role: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. diagnostic agent A substance administered to aid diagnosis of a disease. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapropterin dihydrochloride (CHEBI:32120) has part sapropterin (CHEBI:59560) |
| sapropterin dihydrochloride (CHEBI:32120) has role anti-anaemic agent (CHEBI:75835) |
| sapropterin dihydrochloride (CHEBI:32120) has role antihypertensive agent (CHEBI:35674) |
| sapropterin dihydrochloride (CHEBI:32120) has role antineoplastic agent (CHEBI:35610) |
| sapropterin dihydrochloride (CHEBI:32120) has role antipsychotic agent (CHEBI:35476) |
| sapropterin dihydrochloride (CHEBI:32120) has role cardiovascular drug (CHEBI:35554) |
| sapropterin dihydrochloride (CHEBI:32120) has role coenzyme (CHEBI:23354) |
| sapropterin dihydrochloride (CHEBI:32120) has role diagnostic agent (CHEBI:33295) |
| sapropterin dihydrochloride (CHEBI:32120) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (6R)-2-amino-6-[(1R,2S)-1,2-dihydroxypropyl]-5,6,7,8-tetrahydropteridin-4(3H)-one dihydrochloride |
| Synonyms | Source |
|---|---|
| (6R)-tetrahydrobiopterin dihydrochloride | ChEBI |
| (6R)-tetrahydrobiopterin hydrochloride | ChemIDplus |
| Biopten | ChEMBL |
| Dapropterin hydrochloride | ChEMBL |
| Phenoptin | ChEMBL |
| sapropterin 2HCl | ChEBI |
| Brand Name | Source |
|---|---|
| Sapropterin dipharma | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01798 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12490572 | Reaxys |
| Beilstein:4613446 | Beilstein |
| CAS:69056-38-8 | KEGG DRUG |
| CAS:69056-38-8 | ChemIDplus |
| Citations |
|---|