EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H25F2N3OS |
| Net Charge | 0 |
| Average Mass | 477.580 |
| Monoisotopic Mass | 477.16864 |
| SMILES | Cc1nc2sccn2c(=O)c1CCN1CCC(=C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H25F2N3OS/c1-18-24(26(33)32-16-17-34-27(32)30-18)12-15-31-13-10-21(11-14-31)25(19-2-6-22(28)7-3-19)20-4-8-23(29)9-5-20/h2-9,16-17H,10-15H2,1H3 |
| InChIKey | JUQLTPCYUFPYKE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. dopaminergic antagonist A drug that binds to but does not activate dopamine receptors, thereby blocking the actions of dopamine or exogenous agonists. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ritanserin (CHEBI:64195) has role antidepressant (CHEBI:35469) |
| ritanserin (CHEBI:64195) has role antipsychotic agent (CHEBI:35476) |
| ritanserin (CHEBI:64195) has role anxiolytic drug (CHEBI:35474) |
| ritanserin (CHEBI:64195) has role dopaminergic antagonist (CHEBI:48561) |
| ritanserin (CHEBI:64195) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| ritanserin (CHEBI:64195) has role serotonergic antagonist (CHEBI:48279) |
| ritanserin (CHEBI:64195) is a organofluorine compound (CHEBI:37143) |
| ritanserin (CHEBI:64195) is a piperidines (CHEBI:26151) |
| ritanserin (CHEBI:64195) is a thiazolopyrimidine (CHEBI:64196) |
| IUPAC Name |
|---|
| 6-(2-{4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl}ethyl)-7-methyl-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| INNs | Source |
|---|---|
| ritanserin | ChemIDplus |
| ritanserina | ChemIDplus |
| ritanserine | ChemIDplus |
| ritanserinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 6-(2-(4-(bis(p-fluorophenyl)methylene)-piperidino)ethyl)-7-methyl-5H-thiazolo-(3,2-a)pyrimidin-5-one | ChemIDplus |
| R 55,667 | ChemIDplus |
| R-55667 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D05738 | KEGG DRUG |
| LSM-2906 | LINCS |
| Ritanserin | Wikipedia |
| US4533665 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4913835 | Reaxys |
| CAS:87051-43-2 | ChemIDplus |
| Citations |
|---|