EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H.C14H17ClN4S |
| Net Charge | +2 |
| Average Mass | 310.854 |
| Monoisotopic Mass | 310.10080 |
| SMILES | N=C(NCc1ccc(Cl)cc1)SCCCc1cncn1.[H+].[H+] |
| InChI | InChI=1S/C14H17ClN4S/c15-12-5-3-11(4-6-12)8-18-14(16)20-7-1-2-13-9-17-10-19-13/h3-6,9-10H,1-2,7-8H2,(H2,16,18)(H,17,19)/p+2 |
| InChIKey | UCAIEVHKDLMIFL-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clobenpropit(2+) (CHEBI:64193) is a organic cation (CHEBI:25697) |
| clobenpropit(2+) (CHEBI:64193) is conjugate acid of clobenpropit (CHEBI:64177) |
| Incoming Relation(s) |
| clobenpropit dihydrobromide (CHEBI:64165) has part clobenpropit(2+) (CHEBI:64193) |
| clobenpropit (CHEBI:64177) is conjugate base of clobenpropit(2+) (CHEBI:64193) |
| Synonym | Source |
|---|---|
| clobenpropit dication | ChEBI |