EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17ClN4S |
| Net Charge | 0 |
| Average Mass | 308.838 |
| Monoisotopic Mass | 308.08625 |
| SMILES | N=C(NCc1ccc(Cl)cc1)SCCCc1cncn1 |
| InChI | InChI=1S/C14H17ClN4S/c15-12-5-3-11(4-6-12)8-18-14(16)20-7-1-2-13-9-17-10-19-13/h3-6,9-10H,1-2,7-8H2,(H2,16,18)(H,17,19) |
| InChIKey | UCAIEVHKDLMIFL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H4-receptor agonist A histamine agonist that binds to and activates H4-receptors. H3-receptor antagonist A histamine antagonist that selectively binds to but does not activate histamine H3 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H4-receptor agonist A histamine agonist that binds to and activates H4-receptors. H3-receptor antagonist A histamine antagonist that selectively binds to but does not activate histamine H3 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clobenpropit (CHEBI:64177) has role H3-receptor antagonist (CHEBI:64176) |
| clobenpropit (CHEBI:64177) has role H4-receptor agonist (CHEBI:64155) |
| clobenpropit (CHEBI:64177) is a imidazoles (CHEBI:24780) |
| clobenpropit (CHEBI:64177) is a imidothiocarbamic ester (CHEBI:38914) |
| clobenpropit (CHEBI:64177) is a organochlorine compound (CHEBI:36683) |
| clobenpropit (CHEBI:64177) is conjugate base of clobenpropit(2+) (CHEBI:64193) |
| Incoming Relation(s) |
| clobenpropit(2+) (CHEBI:64193) is conjugate acid of clobenpropit (CHEBI:64177) |
| IUPAC Name |
|---|
| 3-(1H-imidazol-4-yl)propyl N-(4-chlorobenzyl)carbamimidothioate |
| Synonym | Source |
|---|---|
| S-(3-(4(5)-Imidazolyl))propyl-N-(4-chlorobenzyl)isothiourea | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C17934 | KEGG COMPOUND |
| Clobenpropit | Wikipedia |
| LSM-3600 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5822910 | Reaxys |
| CAS:145231-45-4 | KEGG COMPOUND |
| CAS:145231-45-4 | ChemIDplus |
| Citations |
|---|