EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N5O11P3 |
| Net Charge | 0 |
| Average Mass | 487.195 |
| Monoisotopic Mass | 487.00592 |
| SMILES | Nc1nc(=O)c2ncn([C@H]3C=C[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C3)c2n1 |
| InChI | InChI=1S/C11H16N5O11P3/c12-11-14-9-8(10(17)15-11)13-5-16(9)7-2-1-6(3-7)4-25-29(21,22)27-30(23,24)26-28(18,19)20/h1-2,5-7H,3-4H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,12,14,15,17)/t6-,7+/m1/s1 |
| InChIKey | CQCAEOCIDCCJDQ-RQJHMYQMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbovir triphosphate (CHEBI:64174) has functional parent (−)-carbovir (CHEBI:421843) |
| carbovir triphosphate (CHEBI:64174) is a organic triphosphate (CHEBI:62894) |
| carbovir triphosphate (CHEBI:64174) is conjugate acid of carbovir triphosphate(4−) (CHEBI:189047) |
| Incoming Relation(s) |
| carbovir triphosphate(4−) (CHEBI:189047) is conjugate base of carbovir triphosphate (CHEBI:64174) |
| IUPAC Name |
|---|
| [(1S,4R)-4-(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)cyclopent-2-en-1-yl]methyl tetrahydrogen triphosphate |
| Synonyms | Source |
|---|---|
| (1S-cis)-triphosphoric acid, P-((4-(2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)-2-cyclopenten-1-yl)methyl) ester | ChEBI |
| (−)-carbovir triphosphate | ChEBI |
| carbovir 5'-triphosphate | ChEBI |
| (−)-carbovir 5'-triphosphate | ChEBI |
| (−)-CBV-TP | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061723 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15808762 | Reaxys |
| CAS:129941-14-6 | ChemIDplus |
| Citations |
|---|