EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N5O2 |
| Net Charge | 0 |
| Average Mass | 247.258 |
| Monoisotopic Mass | 247.10692 |
| SMILES | Nc1nc(=O)c2ncn([C@H]3C=C[C@@H](CO)C3)c2n1 |
| InChI | InChI=1S/C11H13N5O2/c12-11-14-9-8(10(18)15-11)13-5-16(9)7-2-1-6(3-7)4-17/h1-2,5-7,17H,3-4H2,(H3,12,14,15,18)/t6-,7+/m1/s1 |
| InChIKey | XSSYCIGJYCVRRK-RQJHMYQMSA-N |
| Roles Classification |
|---|
| Biological Roles: | HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-carbovir (CHEBI:421843) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| (−)-carbovir (CHEBI:421843) is a carbovir (CHEBI:202940) |
| Incoming Relation(s) |
| carbovir diphosphate (CHEBI:64172) has functional parent (−)-carbovir (CHEBI:421843) |
| carbovir monophosphate (CHEBI:64116) has functional parent (−)-carbovir (CHEBI:421843) |
| carbovir triphosphate (CHEBI:64174) has functional parent (−)-carbovir (CHEBI:421843) |
| IUPAC Name |
|---|
| 2-amino-9-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-1,9-dihydro-6H-purin-6-one |
| Synonyms | Source |
|---|---|
| (1R-cis)-2-amino-1,9-dihydro-9-(4-(hydroxymethyl)-2-cyclopenten-1-yl)-6H-purin-6-one | ChEBI |
| 2-amino-9-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-9H-purin-6-ol | IUPAC |
| carbovir | ChEBI |
| CBV | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:120443-30-3 | ChemIDplus |
| Citations |
|---|