EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26NS |
| Net Charge | +1 |
| Average Mass | 300.491 |
| Monoisotopic Mass | 300.17805 |
| SMILES | c1ccc2sc(C3([NH+]4CCCCC4)CCCCC3)cc2c1 |
| InChI | InChI=1S/C19H25NS/c1-5-11-19(12-6-1,20-13-7-2-8-14-20)18-15-16-9-3-4-10-17(16)21-18/h3-4,9-10,15H,1-2,5-8,11-14H2/p+1 |
| InChIKey | RGSVXQJPSWZXOP-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) is a ammonium ion derivative (CHEBI:35274) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) is a organic cation (CHEBI:25697) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) is conjugate acid of 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine (CHEBI:64145) |
| Incoming Relation(s) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine hydrochloride (CHEBI:180491) has part 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine maleate (CHEBI:64144) has part 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine (CHEBI:64145) is conjugate base of 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) |
| IUPAC Name |
|---|
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium |
| Synonyms | Source |
|---|---|
| BTCP(1+) | ChEBI |
| BTCP cation | ChEBI |
| benocyclidine(1+) | ChEBI |
| benocyclidine cation | ChEBI |