EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NS.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 415.555 |
| Monoisotopic Mass | 415.18173 |
| SMILES | O=C(O)/C=C\C(=O)O.c1ccc2sc(C3(N4CCCCC4)CCCCC3)cc2c1 |
| InChI | InChI=1S/C19H25NS.C4H4O4/c1-5-11-19(12-6-1,20-13-7-2-8-14-20)18-15-16-9-3-4-10-17(16)21-18;5-3(6)1-2-4(7)8/h3-4,9-10,15H,1-2,5-8,11-14H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | AMTYJSWZECGJOO-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine maleate (CHEBI:64144) has part 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium(1+) (CHEBI:64146) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine maleate (CHEBI:64144) has role dopamine uptake inhibitor (CHEBI:51039) |
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine maleate (CHEBI:64144) is a maleate salt (CHEBI:50221) |
| IUPAC Name |
|---|
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 1-[1-(1-benzothiophen-2-yl)cyclohexyl]piperidinium (2Z)-3-carboxyacrylate | IUPAC |
| benocyclidine maleate | ChEBI |
| BTCP maleate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8426776 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:207455-25-2 | ChEBI |