EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C14H23N5O |
| Net Charge | +1 |
| Average Mass | 278.380 |
| Monoisotopic Mass | 278.19754 |
| SMILES | CCCCCC[C@@H]([C@@H](C)O)n1cnc2c(N)ncnc21.[H+] |
| InChI | InChI=1S/C14H23N5O/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17)/p+1/t10-,11+/m1/s1 |
| InChIKey | IOSAAWHGJUZBOG-MNOVXSKESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-EHNA(1+) (CHEBI:64140) is a organic cation (CHEBI:25697) |
| (2R,3S)-EHNA(1+) (CHEBI:64140) is conjugate acid of (2R,3S)-EHNA (CHEBI:63058) |
| Incoming Relation(s) |
| (2R,3S)-EHNA hydrochloride (CHEBI:64139) has part (2R,3S)-EHNA(1+) (CHEBI:64140) |
| (2R,3S)-EHNA (CHEBI:63058) is conjugate base of (2R,3S)-EHNA(1+) (CHEBI:64140) |
| Synonym | Source |
|---|---|
| (2R,3S)-EHNA cation | ChEBI |