EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N5O.HCl |
| Net Charge | 0 |
| Average Mass | 313.833 |
| Monoisotopic Mass | 313.16694 |
| SMILES | CCCCCC[C@@H]([C@@H](C)O)n1cnc2c(N)ncnc21.Cl |
| InChI | InChI=1S/C14H23N5O.ClH/c1-3-4-5-6-7-11(10(2)20)19-9-18-12-13(15)16-8-17-14(12)19;/h8-11,20H,3-7H2,1-2H3,(H2,15,16,17);1H/t10-,11+;/m1./s1 |
| InChIKey | VVDXNJRUNJMYOZ-DHXVBOOMSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.4.4 (adenosine deaminase) inhibitor An EC 3.5.4.* (non-peptide cyclic amidine C-N hydrolase) inhibitor that interferes with the action of adenosine deaminase (EC 3.5.4.4). EC 3.1.4.* (phosphoric diester hydrolase) inhibitor An EC 3.1.* (ester hydrolase) inhibitor that interferes with the action of a phosphoric diester hydrolase (EC 3.1.4.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3S)-EHNA hydrochloride (CHEBI:64139) has part (2R,3S)-EHNA(1+) (CHEBI:64140) |
| (2R,3S)-EHNA hydrochloride (CHEBI:64139) has role EC 3.1.4.* (phosphoric diester hydrolase) inhibitor (CHEBI:50218) |
| (2R,3S)-EHNA hydrochloride (CHEBI:64139) has role EC 3.5.4.4 (adenosine deaminase) inhibitor (CHEBI:50445) |
| (2R,3S)-EHNA hydrochloride (CHEBI:64139) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| (2R,3S)-3-(6-amino-9H-purin-9-yl)nonan-2-ol hydrochloride |
| Synonyms | Source |
|---|---|
| (2R,3S)-3-(adenin-9-yl)-2-nonanol hydrochloride | ChEBI |
| (2R,3S)-9-(2-hydroxy-3-nonyl)adenine hydrochloride | ChEBI |
| (2R,3S)-EHNA.HCl | ChEBI |
| erythro-9-(2-hydroxy-3-nonyl)adenine hydrochloride | ChEBI |
| (R,S)-6-amino-β-hexyl-α-methyl-9H-purine-9-ethanol hydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4729841 | Reaxys |