EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10BrN5O7P.Na |
| Net Charge | 0 |
| Average Mass | 446.086 |
| Monoisotopic Mass | 444.93989 |
| SMILES | Nc1nc(=O)c2nc(Br)n([C@@H]3O[C@@H]4COP(=O)([O-])O[C@H]4[C@H]3O)c2n1.[Na+] |
| InChI | InChI=1S/C10H11BrN5O7P.Na/c11-9-13-3-6(14-10(12)15-7(3)18)16(9)8-4(17)5-2(22-8)1-21-24(19,20)23-5;/h2,4-5,8,17H,1H2,(H,19,20)(H3,12,14,15,18);/q;+1/p-1/t2-,4-,5-,8-;/m1./s1 |
| InChIKey | ZJRFCXHKYQVNFK-YEOHUATISA-M |
| Roles Classification |
|---|
| Biological Role: | protein kinase G agonist An agonist that selectively binds to and activates a protein kinase G receptor. |
| Application: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium 8-bromo-3',5'-cyclic GMP (CHEBI:64104) has part 8-bromo-3',5'-cyclic GMP(1−) (CHEBI:64107) |
| sodium 8-bromo-3',5'-cyclic GMP (CHEBI:64104) has role muscle relaxant (CHEBI:51371) |
| sodium 8-bromo-3',5'-cyclic GMP (CHEBI:64104) has role protein kinase G agonist (CHEBI:64105) |
| sodium 8-bromo-3',5'-cyclic GMP (CHEBI:64104) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 8-bromoguanosine 3',5'-phosphate |
| Synonyms | Source |
|---|---|
| 8-bromo cGMP sodium salt | ChEBI |
| 8-bromoguanosine 3',5'-cyclic phosphate sodium | ChEBI |
| 8-bromoguanosine 3',5'-cyclic phosphate sodium salt | ChEBI |
| sodium 8-bromoguanosine 3',5'-cyclic phosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8378760 | Reaxys |