EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14BrN3O5P |
| Net Charge | +1 |
| Average Mass | 379.127 |
| Monoisotopic Mass | 377.98490 |
| SMILES | C[C@@H]([NH2+]Cc1cc(Br)cc2nc(=O)c(=O)nc12)P(=O)(O)O |
| InChI | InChI=1S/C11H13BrN3O5P/c1-5(21(18,19)20)13-4-6-2-7(12)3-8-9(6)15-11(17)10(16)14-8/h2-3,5,13H,4H2,1H3,(H,14,16)(H,15,17)(H2,18,19,20)/p+1/t5-/m0/s1 |
| InChIKey | DPFHVUSPVHRVFL-YFKPBYRVSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CGP 78608(1+) (CHEBI:64066) is a ammonium ion derivative (CHEBI:35274) |
| CGP 78608(1+) (CHEBI:64066) is a organic cation (CHEBI:25697) |
| CGP 78608(1+) (CHEBI:64066) is conjugate acid of CGP 78608 hydrochloride (CHEBI:64065) |
| Incoming Relation(s) |
| CGP 78608 (CHEBI:64061) has part CGP 78608(1+) (CHEBI:64066) |
| CGP 78608 hydrochloride (CHEBI:64065) is conjugate base of CGP 78608(1+) (CHEBI:64066) |
| Synonym | Source |
|---|---|
| CGP 78608 cation | ChEBI |