EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13BrN3O5P |
| Net Charge | 0 |
| Average Mass | 378.119 |
| Monoisotopic Mass | 376.97762 |
| SMILES | C[C@@H](NCc1cc(Br)cc2nc(=O)c(=O)nc12)P(=O)(O)O |
| InChI | InChI=1S/C11H13BrN3O5P/c1-5(21(18,19)20)13-4-6-2-7(12)3-8-9(6)15-11(17)10(16)14-8/h2-3,5,13H,4H2,1H3,(H,14,16)(H,15,17)(H2,18,19,20)/t5-/m0/s1 |
| InChIKey | DPFHVUSPVHRVFL-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CGP 78608 (CHEBI:64061) has part CGP 78608(1+) (CHEBI:64066) |
| CGP 78608 (CHEBI:64061) has role anticonvulsant (CHEBI:35623) |
| CGP 78608 (CHEBI:64061) has role NMDA receptor antagonist (CHEBI:60643) |
| CGP 78608 (CHEBI:64061) is a organobromine compound (CHEBI:37141) |
| CGP 78608 (CHEBI:64061) is a phosphonic acids (CHEBI:26069) |
| CGP 78608 (CHEBI:64061) is a quinoxaline derivative (CHEBI:38771) |
| CGP 78608 (CHEBI:64061) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| [(1S)-1-{[(7-bromo-2,3-dioxo-1,2,3,4-tetrahydroquinoxalin-5-yl)methyl]amino}ethyl]phosphonic acid |
| Manual Xrefs | Databases |
|---|---|
| US6117873 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8227979 | Reaxys |
| Citations |
|---|