EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37NO4 |
| Net Charge | 0 |
| Average Mass | 415.574 |
| Monoisotopic Mass | 415.27226 |
| SMILES | OCc1cc([C@@H](O)CNCCCCCCOCCCCc2ccccc2)ccc1O |
| InChI | InChI=1S/C25H37NO4/c27-20-23-18-22(13-14-24(23)28)25(29)19-26-15-7-1-2-8-16-30-17-9-6-12-21-10-4-3-5-11-21/h3-5,10-11,13-14,18,25-29H,1-2,6-9,12,15-17,19-20H2/t25-/m0/s1 |
| InChIKey | GIIZNNXWQWCKIB-VWLOTQADSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-salmeterol (CHEBI:64062) is a 2-(hydroxymethyl)-4-(1-hydroxy-2-{[6-(4-phenylbutoxy)hexyl]amino}ethyl)phenol (CHEBI:64064) |
| (R)-salmeterol (CHEBI:64062) is enantiomer of (S)-salmeterol (CHEBI:64063) |
| Incoming Relation(s) |
| salmeterol (CHEBI:9011) has part (R)-salmeterol (CHEBI:64062) |
| (S)-salmeterol (CHEBI:64063) is enantiomer of (R)-salmeterol (CHEBI:64062) |
| Synonyms | Source |
|---|---|
| 2-(hydroxymethyl)-4-((1R)-1-hydroxy-2-{[6-(4-phenylbutoxy)hexyl]amino}ethyl)phenol | ChEBI |
| 2-(hydroxymethyl)-4-[(1R)-1-hydroxy-2-{[6-(4-phenylbutoxy)hexyl]amino}ethyl]phenol | ChEBI |
| (R)-4-(1-hydroxy-2-(6-(4-phenylbutoxy)hexylamino)ethyl)-2-(hydroxymethyl)phenol | ChEBI |
| (R)-(−)-salmeterol | ChEBI |
| (R)-α-[((6-(4-phenylbutoxy)hexyl)amino)methy]-4-hydroxy-1,3-benzenedimethanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7082712 | Reaxys |