EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14N4O6S2 |
| Net Charge | 0 |
| Average Mass | 470.488 |
| Monoisotopic Mass | 470.03548 |
| SMILES | O=S(=O)(O)c1ccc(-c2nnc(-c3ccccn3)nc2-c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H14N4O6S2/c25-31(26,27)15-8-4-13(5-9-15)18-19(14-6-10-16(11-7-14)32(28,29)30)23-24-20(22-18)17-3-1-2-12-21-17/h1-12H,(H,25,26,27)(H,28,29,30) |
| InChIKey | JFVUMQYWYNDZDK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferrozine free acid (CHEBI:63946) has role iron chelator (CHEBI:38157) |
| ferrozine free acid (CHEBI:63946) is a 1,2,4-triazines (CHEBI:39410) |
| ferrozine free acid (CHEBI:63946) is a arenesulfonic acid (CHEBI:33555) |
| ferrozine free acid (CHEBI:63946) is a pyridines (CHEBI:26421) |
| ferrozine free acid (CHEBI:63946) is conjugate acid of ferrozine(2−) (CHEBI:63945) |
| Incoming Relation(s) |
| ferrozine(2−) (CHEBI:63945) is conjugate base of ferrozine free acid (CHEBI:63946) |
| IUPAC Name |
|---|
| 4,4'-[3-(pyridin-2-yl)-1,2,4-triazine-5,6-diyl]dibenzenesulfonic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1190473 | Reaxys |
| CAS:32796-55-7 | ChemIDplus |