EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O8 |
| Net Charge | 0 |
| Average Mass | 384.425 |
| Monoisotopic Mass | 384.17842 |
| SMILES | [H][C@]12O[C@@H](OC(=O)CCC(=O)O)[C@H](C)[C@]3([H])CC[C@@H](C)[C@]4([H])CC[C@@](C)(OO[C@]143)O2 |
| InChI | InChI=1S/C19H28O8/c1-10-4-5-13-11(2)16(23-15(22)7-6-14(20)21)24-17-19(13)12(10)8-9-18(3,25-17)26-27-19/h10-13,16-17H,4-9H2,1-3H3,(H,20,21)/t10-,11-,12+,13+,16-,17-,18-,19-/m1/s1 |
| InChIKey | FIHJKUPKCHIPAT-AHIGJZGOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. ferroptosis inducer Any substance that induces or promotes ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| artesunate (CHEBI:63918) has role antimalarial (CHEBI:38068) |
| artesunate (CHEBI:63918) has role antineoplastic agent (CHEBI:35610) |
| artesunate (CHEBI:63918) has role ferroptosis inducer (CHEBI:173085) |
| artesunate (CHEBI:63918) is a artemisinin derivative (CHEBI:63920) |
| artesunate (CHEBI:63918) is a cyclic acetal (CHEBI:59770) |
| artesunate (CHEBI:63918) is a dicarboxylic acid monoester (CHEBI:36244) |
| artesunate (CHEBI:63918) is a hemisuccinate (CHEBI:138979) |
| artesunate (CHEBI:63918) is a semisynthetic derivative (CHEBI:72588) |
| artesunate (CHEBI:63918) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 4-oxo-4-{[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-3,6,9-trimethyldecahydro-3,12-epoxypyrano[4,3-j][1,2]benzodioxepin-10-yl]oxy}butanoic acid |
| INNs | Source |
|---|---|
| artesunate | ChemIDplus |
| artesunatum | ChemIDplus |
| artesunato | ChemIDplus |
| Synonyms | Source |
|---|---|
| dihydroqinghasu hemsuccinate | ChemIDplus |
| artesunic acid | ChemIDplus |
| butanedioic acid, 1-[(3R,5aS,6R,8aS,9R,10S,12R,12aR)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-yl] ester | NIST Chemistry WebBook |
| AS | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D02482 | KEGG DRUG |
| Artesunate | Wikipedia |
| 247 | DrugCentral |
| DB09274 | DrugBank |
| HMDB0240267 | HMDB |
| 5293084 | ChemSpider |
| D95 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6003212 | Reaxys |
| CAS:182824-33-5 | ChemIDplus |
| CAS:88495-63-0 | ChemIDplus |
| CAS:88495-63-0 | NIST Chemistry WebBook |
| CAS:88495-63-0 | KEGG DRUG |
| Citations |
|---|