EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C47H51NO15 |
| Net Charge | 0 |
| Average Mass | 869.917 |
| Monoisotopic Mass | 869.32587 |
| SMILES | [H][C@]12[C@H](OC(=O)c3ccccc3)[C@]3(O)C[C@H](OC(=O)[C@H](O)[C@@H](NC(=O)c4ccccc4)c4ccccc4)C(C)=C([C@@H](OC(C)=O)C(=O)[C@]1(C)[C@@H](O)[C@H](O)[C@H]1OC[C@]12OC(C)=O)C3(C)C |
| InChI | InChI=1S/C47H51NO15/c1-24-30(61-43(57)33(51)32(27-16-10-7-11-17-27)48-41(55)28-18-12-8-13-19-28)22-47(58)40(62-42(56)29-20-14-9-15-21-29)36-45(6,38(54)35(60-25(2)49)31(24)44(47,4)5)37(53)34(52)39-46(36,23-59-39)63-26(3)50/h7-21,30,32-37,39-40,51-53,58H,22-23H2,1-6H3,(H,48,55)/t30-,32-,33+,34-,35+,36-,37-,39+,40-,45-,46+,47+/m0/s1 |
| InChIKey | NDCWHEDPSFRTDA-FJMWQILYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-hydroxypaclitaxel (CHEBI:63859) has functional parent paclitaxel (CHEBI:45863) |
| 6-hydroxypaclitaxel (CHEBI:63859) has role antineoplastic agent (CHEBI:35610) |
| 6-hydroxypaclitaxel (CHEBI:63859) is a taxane diterpenoid (CHEBI:50367) |
| 6-hydroxypaclitaxel (CHEBI:63859) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (2α,5β,6α,7β,10β,13α)-4,10-diacetoxy-13-{[(2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy}-1,6,7-trihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate |
| Synonyms | Source |
|---|---|
| 6-hydroxytaxol | ChEBI |
| 6α-hydroxypaclitaxel | ChEBI |
| 6α-hydroxytaxol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8105272 | Reaxys |
| CAS:153212-75-0 | ChemIDplus |