EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63845 - sulfacetamide
| Formula | C8H10N2O3S |
| Net Charge | 0 |
| Average Mass | 214.246 |
| Monoisotopic Mass | 214.04121 |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C8H10N2O3S/c1-6(11)10-14(12,13)8-4-2-7(9)3-5-8/h2-5H,9H2,1H3,(H,10,11) |
| InChIKey | SKIVFJLNDNKQPD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.5.1.15 (dihydropteroate synthase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of dihydropteroate synthase (EC 2.5.1.15), an enzyme that catalyzes the formation of dihydropteroate from p-aminobenzoic acid and dihydropteridine-hydroxymethyl-pyrophosphate. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfacetamide (CHEBI:63845) has functional parent sulfanilamide (CHEBI:45373) |
| sulfacetamide (CHEBI:63845) has role antibacterial drug (CHEBI:36047) |
| sulfacetamide (CHEBI:63845) has role antiinfective agent (CHEBI:35441) |
| sulfacetamide (CHEBI:63845) has role antimicrobial agent (CHEBI:33281) |
| sulfacetamide (CHEBI:63845) has role EC 2.5.1.15 (dihydropteroate synthase) inhibitor (CHEBI:50502) |
| sulfacetamide (CHEBI:63845) is a N-sulfonylcarboxamide (CHEBI:90852) |
| sulfacetamide (CHEBI:63845) is a substituted aniline (CHEBI:48975) |
| sulfacetamide (CHEBI:63845) is conjugate acid of sulfacetamide(1−) (CHEBI:63857) |
| Incoming Relation(s) |
| sulfacetamide(1−) (CHEBI:63857) is conjugate base of sulfacetamide (CHEBI:63845) |
| IUPAC Name |
|---|
| N-[(4-aminophenyl)sulfonyl]acetamide |
| INNs | Source |
|---|---|
| sulfacetamide | KEGG DRUG |
| sulfacetamida | ChemIDplus |
| sulfacetamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| p-Aminobenzenesulfonacetamide | DrugBank |
| N'-Acetylsulfanilamide | DrugBank |
| N-Acetylsulfanilamide | DrugBank |
| N-Sulfanilylacetamide | DrugBank |
| N1-acetylsulfanilamide | ChemIDplus |
| N1-acetyl-4-aminophenylsulfonamide | ChemIDplus |
| Citations |
|---|