EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O3 |
| Net Charge | 0 |
| Average Mass | 128.127 |
| Monoisotopic Mass | 128.04734 |
| SMILES | C/C=C\C=C(/O)C(=O)O |
| InChI | InChI=1S/C6H8O3/c1-2-3-4-5(7)6(8)9/h2-4,7H,1H3,(H,8,9)/b3-2-,5-4- |
| InChIKey | VPGPQVKJUYKKNN-LDIADDGTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid (CHEBI:63735) is a enol (CHEBI:33823) |
| (2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid (CHEBI:63735) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid (CHEBI:63735) is conjugate acid of (2Z,4Z)-2-hydroxyhexa-2,4-dienoate (CHEBI:63693) |
| Incoming Relation(s) |
| (2Z,4Z)-2-hydroxyhexa-2,4-dienoate (CHEBI:63693) is conjugate base of (2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid (CHEBI:63735) |
| IUPAC Name |
|---|
| (2Z,4Z)-2-hydroxyhexa-2,4-dienoic acid |
| Synonym | Source |
|---|---|
| (Z,Z)-2-hydroxyhexa-2,4-dienoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8198424 | Reaxys |
| Citations |
|---|