EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N5O6.2Na |
| Net Charge | 0 |
| Average Mass | 471.381 |
| Monoisotopic Mass | 471.11307 |
| SMILES | Nc1nc(=O)c2c(CCc3ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc3)cnc2n1.[Na+].[Na+] |
| InChI | InChI=1S/C20H21N5O6.2Na/c21-20-24-16-15(18(29)25-20)12(9-22-16)6-3-10-1-4-11(5-2-10)17(28)23-13(19(30)31)7-8-14(26)27;;/h1-2,4-5,9,13H,3,6-8H2,(H,23,28)(H,26,27)(H,30,31)(H4,21,22,24,25,29);;/q;2*+1/p-2/t13-;;/m0../s1 |
| InChIKey | NYDXNILOWQXUOF-GXKRWWSZSA-L |
| Roles Classification |
|---|
| Biological Roles: | EC 2.1.1.45 (thymidylate synthase) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of thymidylate synthase (EC 2.1.1.45). EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). EC 2.1.2.2 (phosphoribosylglycinamide formyltransferase) inhibitor An EC 2.1.2.* (hydroxymethyl-, formyl- and related transferases) inhibitor that interferes with the action of phosphoribosylglycinamide formyltransferase (EC 2.1.2.2). antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pemetrexed disodium (CHEBI:63722) has part pemetrexed(2−) (CHEBI:63724) |
| pemetrexed disodium (CHEBI:63722) has role antimetabolite (CHEBI:35221) |
| pemetrexed disodium (CHEBI:63722) has role antineoplastic agent (CHEBI:35610) |
| pemetrexed disodium (CHEBI:63722) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| pemetrexed disodium (CHEBI:63722) has role EC 2.1.1.45 (thymidylate synthase) inhibitor (CHEBI:63720) |
| pemetrexed disodium (CHEBI:63722) has role EC 2.1.2.2 (phosphoribosylglycinamide formyltransferase) inhibitor (CHEBI:63721) |
| pemetrexed disodium (CHEBI:63722) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| pemetrexed disodium heptahydrate (CHEBI:63723) has part pemetrexed disodium (CHEBI:63722) |
| IUPAC Name |
|---|
| disodium N-{4-[2-(2-amino-4-oxo-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl}-L-glutamate |
| Synonym | Source |
|---|---|
| disodium (2S)-2-({4-[2-(2-amino-4-oxo-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl}amino)pentanedioate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| CN101411710 | Patent |
| CN101560206 | Patent |
| D03828 | KEGG DRUG |
| DB00642 | DrugBank |
| EP2301909 | Patent |
| EP2334685 | Patent |
| US2009181990 | Patent |
| US2011124861 | Patent |
| US2011196154 | Patent |
| WO2010028105 | Patent |
| WO2011019986 | Patent |
| WO2011064256 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8964395 | Reaxys |
| CAS:150399-23-8 | ChemIDplus |
| CAS:150399-23-8 | KEGG DRUG |
| Citations |
|---|