EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16F6N2O |
| Net Charge | 0 |
| Average Mass | 378.316 |
| Monoisotopic Mass | 378.11668 |
| SMILES | O[C@H](c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C17H16F6N2O/c18-16(19,20)11-5-3-4-9-10(15(26)12-6-1-2-7-24-12)8-13(17(21,22)23)25-14(9)11/h3-5,8,12,15,24,26H,1-2,6-7H2/t12-,15+/m0/s1 |
| InChIKey | XEEQGYMUWCZPDN-SWLSCSKDSA-N |
| Roles Classification |
|---|
| Biological Role: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(11R,2'S)-erythro-mefloquine (CHEBI:63684) has role antimalarial (CHEBI:38068) |
| (+)-(11R,2'S)-erythro-mefloquine (CHEBI:63684) is a [2,8-bis(trifluoromethyl)quinolin-4-yl]-(2-piperidyl)methanol (CHEBI:63681) |
| (+)-(11R,2'S)-erythro-mefloquine (CHEBI:63684) is enantiomer of (−)-(11S,2'R)-erythro-mefloquine (CHEBI:63687) |
| Incoming Relation(s) |
| mefloquine (CHEBI:63609) has part (+)-(11R,2'S)-erythro-mefloquine (CHEBI:63684) |
| (−)-(11S,2'R)-erythro-mefloquine (CHEBI:63687) is enantiomer of (+)-(11R,2'S)-erythro-mefloquine (CHEBI:63684) |
| IUPAC Name |
|---|
| (R)-[2,8-bis(trifluoromethyl)quinolin-4-yl][(2S)-piperidin-2-yl]methanol |
| Synonyms | Source |
|---|---|
| [(11R,2'S)-2,8-bis(trifluoromethyl)quinolin-4-yl]-(2-piperidyl)methanol | ChEBI |
| (+)-mefloquine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:766169 | Reaxys |
| CAS:51688-68-7 | ChemIDplus |