EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6367 - lamotrigine
| Formula | C9H7Cl2N5 |
| Net Charge | 0 |
| Average Mass | 256.096 |
| Monoisotopic Mass | 255.00785 |
| SMILES | Nc1nnc(-c2cccc(Cl)c2Cl)c(N)n1 |
| InChI | InChI=1S/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16) |
| InChIKey | PYZRQGJRPPTADH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | excitatory amino acid antagonist Any substance which inhibits the action of receptors for excitatory amino acids. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamotrigine (CHEBI:6367) has role anticonvulsant (CHEBI:35623) |
| lamotrigine (CHEBI:6367) has role antidepressant (CHEBI:35469) |
| lamotrigine (CHEBI:6367) has role antimanic drug (CHEBI:35477) |
| lamotrigine (CHEBI:6367) has role calcium channel blocker (CHEBI:38215) |
| lamotrigine (CHEBI:6367) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| lamotrigine (CHEBI:6367) has role environmental contaminant (CHEBI:78298) |
| lamotrigine (CHEBI:6367) has role excitatory amino acid antagonist (CHEBI:60798) |
| lamotrigine (CHEBI:6367) has role geroprotector (CHEBI:176497) |
| lamotrigine (CHEBI:6367) has role non-narcotic analgesic (CHEBI:35481) |
| lamotrigine (CHEBI:6367) has role xenobiotic (CHEBI:35703) |
| lamotrigine (CHEBI:6367) is a 1,2,4-triazines (CHEBI:39410) |
| lamotrigine (CHEBI:6367) is a dichlorobenzene (CHEBI:23697) |
| lamotrigine (CHEBI:6367) is a primary arylamine (CHEBI:50471) |
| IUPAC Name |
|---|
| 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| INNs | Source |
|---|---|
| lamotrigina | ChemIDplus |
| lamotrigine | ChemIDplus |
| lamotriginum | ChemIDplus |
| Synonym | Source |
|---|---|
| 3,5-diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Lamictal | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1540 | DrugCentral |
| D00354 | KEGG DRUG |
| DB00555 | DrugBank |
| HMDB0014695 | HMDB |
| Lamotrigine | Wikipedia |
| LSM-4104 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7589268 | Reaxys |
| CAS:84057-84-1 | KEGG DRUG |
| CAS:84057-84-1 | ChemIDplus |
| CAS:84057-84-1 | NIST Chemistry WebBook |
| Citations |
|---|