EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6367 - lamotrigine
| Formula | C9H7Cl2N5 |
| Net Charge | 0 |
| Average Mass | 256.096 |
| Monoisotopic Mass | 255.00785 |
| SMILES | Nc1nnc(-c2cccc(Cl)c2Cl)c(N)n1 |
| InChI | InChI=1S/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16) |
| InChIKey | PYZRQGJRPPTADH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. EC 3.4.21.26 (prolyl oligopeptidase) inhibitor Any EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of prolyl oligopeptidase (EC 3.4.21.26). xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. excitatory amino acid antagonist Any substance which inhibits the action of receptors for excitatory amino acids. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. anticonvulsant A drug used to prevent seizures or reduce their severity. antimanic drug Antimanic drugs are agents used to treat bipolar disorders or mania associated with other affective disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lamotrigine (CHEBI:6367) has role anticonvulsant (CHEBI:35623) |
| lamotrigine (CHEBI:6367) has role antidepressant (CHEBI:35469) |
| lamotrigine (CHEBI:6367) has role antimanic drug (CHEBI:35477) |
| lamotrigine (CHEBI:6367) has role calcium channel blocker (CHEBI:38215) |
| lamotrigine (CHEBI:6367) has role EC 3.4.21.26 (prolyl oligopeptidase) inhibitor (CHEBI:76779) |
| lamotrigine (CHEBI:6367) has role environmental contaminant (CHEBI:78298) |
| lamotrigine (CHEBI:6367) has role excitatory amino acid antagonist (CHEBI:60798) |
| lamotrigine (CHEBI:6367) has role geroprotector (CHEBI:176497) |
| lamotrigine (CHEBI:6367) has role non-narcotic analgesic (CHEBI:35481) |
| lamotrigine (CHEBI:6367) has role xenobiotic (CHEBI:35703) |
| lamotrigine (CHEBI:6367) is a 1,2,4-triazines (CHEBI:39410) |
| lamotrigine (CHEBI:6367) is a dichlorobenzene (CHEBI:23697) |
| lamotrigine (CHEBI:6367) is a primary arylamine (CHEBI:50471) |
| IUPAC Name |
|---|
| 6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| INNs | Source |
|---|---|
| lamotrigina | ChemIDplus |
| lamotriginum | ChemIDplus |
| lamotrigine | ChemIDplus |
| Synonym | Source |
|---|---|
| 3,5-diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine | ChemIDplus |
| Brand Name | Source |
|---|---|
| Lamictal | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| DB00555 | DrugBank |
| D00354 | KEGG DRUG |
| Lamotrigine | Wikipedia |
| HMDB0014695 | HMDB |
| LSM-4104 | LINCS |
| 1540 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7589268 | Reaxys |
| CAS:84057-84-1 | KEGG DRUG |
| CAS:84057-84-1 | ChemIDplus |
| CAS:84057-84-1 | NIST Chemistry WebBook |
| Citations |
|---|