EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22N6O5 |
| Net Charge | 0 |
| Average Mass | 354.367 |
| Monoisotopic Mass | 354.16517 |
| SMILES | CC(C)[C@H](N)C(=O)OCC(CO)OCn1cnc2c(=O)nc(N)nc21 |
| InChI | InChI=1S/C14H22N6O5/c1-7(2)9(15)13(23)24-4-8(3-21)25-6-20-5-17-10-11(20)18-14(16)19-12(10)22/h5,7-9,21H,3-4,6,15H2,1-2H3,(H3,16,18,19,22)/t8?,9-/m0/s1 |
| InChIKey | WPVFJKSGQUFQAP-GKAPJAKFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valganciclovir (CHEBI:63635) has functional parent ganciclovir (CHEBI:465284) |
| valganciclovir (CHEBI:63635) has functional parent guanine (CHEBI:16235) |
| valganciclovir (CHEBI:63635) has role antiviral drug (CHEBI:36044) |
| valganciclovir (CHEBI:63635) has role prodrug (CHEBI:50266) |
| valganciclovir (CHEBI:63635) is a L-valyl ester (CHEBI:35855) |
| valganciclovir (CHEBI:63635) is a purines (CHEBI:26401) |
| IUPAC Name |
|---|
| 2-[(2-amino-6-oxo-3,6-dihydro-9H-purin-9-yl)methoxy]-3-hydroxypropyl L-valinate |
| INN | Source |
|---|---|
| valganciclovir | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2801 | DrugCentral |
| D02495 | KEGG DRUG |
| DB01610 | DrugBank |
| Valganciclovir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14503833 | Reaxys |
| CAS:175865-60-8 | ChemIDplus |