EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N5O4 |
| Net Charge | 0 |
| Average Mass | 255.234 |
| Monoisotopic Mass | 255.09675 |
| SMILES | Nc1nc(=O)c2ncn(COC(CO)CO)c2n1 |
| InChI | InChI=1S/C9H13N5O4/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17) |
| InChIKey | IRSCQMHQWWYFCW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ganciclovir (CHEBI:465284) has functional parent guanine (CHEBI:16235) |
| ganciclovir (CHEBI:465284) has role antiinfective agent (CHEBI:35441) |
| ganciclovir (CHEBI:465284) has role antiviral drug (CHEBI:36044) |
| ganciclovir (CHEBI:465284) is a 2-aminopurines (CHEBI:20702) |
| ganciclovir (CHEBI:465284) is a oxopurine (CHEBI:25810) |
| Incoming Relation(s) |
| valganciclovir (CHEBI:63635) has functional parent ganciclovir (CHEBI:465284) |
| IUPAC Name |
|---|
| 2-amino-9-{[(1,3-dihydroxypropan-2-yl)oxy]methyl}-1,9-dihydro-6H-purin-6-one |
| INN | Source |
|---|---|
| ganciclovir | KEGG DRUG |
| Synonyms | Source |
|---|---|
| Ganciclovir | KEGG COMPOUND |
| 9-(1,3-DIHYDROXY-PROPOXYMETHANE)GUANINE | PDBeChem |
| GA2 | DrugBank |
| 2-Amino-9-(2-hydroxy-1-hydroxymethyl-ethoxymethyl)-1,9-dihydro-purin-6-one | ChEMBL |
| 2-amino-9-((1,3-dihydroxypropan-2-yloxy)methyl)-1H-purin-6(9H)-one | ChEMBL |
| 9-[(1,3-dihydroxy-2-propoxy)methyl]guanine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| GA2 | PDBeChem |
| D00333 | KEGG DRUG |
| DB01004 | DrugBank |
| US4355032 | Patent |
| Ganciclovir | Wikipedia |
| HMDB0015139 | HMDB |
| LSM-5382 | LINCS |
| 1277 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3654487 | Beilstein |
| Reaxys:3654487 | Reaxys |
| CAS:82410-32-0 | KEGG COMPOUND |
| CAS:82410-32-0 | KEGG DRUG |
| CAS:82410-32-0 | DrugBank |
| CAS:82410-32-0 | ChemIDplus |
| Citations |
|---|