EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N3O5 |
| Net Charge | 0 |
| Average Mass | 421.453 |
| Monoisotopic Mass | 421.16377 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(CN(C)C)c(O)ccc3nc2-1 |
| InChI | InChI=1S/C23H23N3O5/c1-4-23(30)16-8-18-20-12(9-26(18)21(28)15(16)11-31-22(23)29)7-13-14(10-25(2)3)19(27)6-5-17(13)24-20/h5-8,27,30H,4,9-11H2,1-3H3/t23-/m0/s1 |
| InChIKey | UCFGDBYHRUNTLO-QHCPKHFHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| topotecan (CHEBI:63632) has role antineoplastic agent (CHEBI:35610) |
| topotecan (CHEBI:63632) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| topotecan (CHEBI:63632) is a pyranoindolizinoquinoline (CHEBI:48626) |
| Incoming Relation(s) |
| topotecan hydrochloride (CHEBI:232548) has part topotecan (CHEBI:63632) |
| IUPAC Name |
|---|
| (4S)-10-[(dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione |
| INNs | Source |
|---|---|
| topotecan | ChemIDplus |
| topotecane | ChemIDplus |
| topotecanum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 9-[(dimethylamino)methyl]-10-hydroxy-(4S)-camptothecin | ChEBI |
| Topotecan | KEGG COMPOUND |
| Citations |
|---|