EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8ClN5S |
| Net Charge | 0 |
| Average Mass | 253.718 |
| Monoisotopic Mass | 253.01889 |
| SMILES | Clc1ccc2nsnc2c1NC1=NCCN1 |
| InChI | InChI=1S/C9H8ClN5S/c10-5-1-2-6-8(15-16-14-6)7(5)13-9-11-3-4-12-9/h1-2H,3-4H2,(H2,11,12,13) |
| InChIKey | XFYDIVBRZNQMJC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tizanidine (CHEBI:63629) has role muscle relaxant (CHEBI:51371) |
| tizanidine (CHEBI:63629) has role α-adrenergic agonist (CHEBI:35569) |
| tizanidine (CHEBI:63629) is a benzothiadiazole (CHEBI:48864) |
| tizanidine (CHEBI:63629) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine |
| INNs | Source |
|---|---|
| tizanidina | ChemIDplus |
| tizanidine | ChemIDplus |
| tizanidinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Chloro-4-(2-imidazolin-2-ylamino)-2,1,3-benzothiadiazole | ChemIDplus |
| Tizanidine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:618691 | Reaxys |
| CAS:51322-75-9 | ChemIDplus |
| CAS:51322-75-9 | KEGG COMPOUND |
| Citations |
|---|