EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:63616 - pemetrexed
| Formula | C20H21N5O6 |
| Net Charge | 0 |
| Average Mass | 427.417 |
| Monoisotopic Mass | 427.14918 |
| SMILES | Nc1nc(=O)c2c(CCc3ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc3)cnc2n1 |
| InChI | InChI=1S/C20H21N5O6/c21-20-24-16-15(18(29)25-20)12(9-22-16)6-3-10-1-4-11(5-2-10)17(28)23-13(19(30)31)7-8-14(26)27/h1-2,4-5,9,13H,3,6-8H2,(H,23,28)(H,26,27)(H,30,31)(H4,21,22,24,25,29)/t13-/m0/s1 |
| InChIKey | WBXPDJSOTKVWSJ-ZDUSSCGKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.5.1.3 (dihydrofolate reductase) inhibitor An EC 1.5.1.* (oxidoreductase acting on donor CH-NH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of dihydrofolate reductase (EC 1.5.1.3). EC 2.1.1.45 (thymidylate synthase) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of thymidylate synthase (EC 2.1.1.45). EC 2.1.2.2 (phosphoribosylglycinamide formyltransferase) inhibitor An EC 2.1.2.* (hydroxymethyl-, formyl- and related transferases) inhibitor that interferes with the action of phosphoribosylglycinamide formyltransferase (EC 2.1.2.2). antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pemetrexed (CHEBI:63616) has role antimetabolite (CHEBI:35221) |
| pemetrexed (CHEBI:63616) has role antineoplastic agent (CHEBI:35610) |
| pemetrexed (CHEBI:63616) has role EC 1.5.1.3 (dihydrofolate reductase) inhibitor (CHEBI:50683) |
| pemetrexed (CHEBI:63616) has role EC 2.1.1.45 (thymidylate synthase) inhibitor (CHEBI:63720) |
| pemetrexed (CHEBI:63616) has role EC 2.1.2.2 (phosphoribosylglycinamide formyltransferase) inhibitor (CHEBI:63721) |
| pemetrexed (CHEBI:63616) is a N-acyl-L-glutamic acid (CHEBI:21650) |
| pemetrexed (CHEBI:63616) is a pyrrolopyrimidine (CHEBI:38670) |
| pemetrexed (CHEBI:63616) is conjugate acid of pemetrexed(2−) (CHEBI:63724) |
| Incoming Relation(s) |
| pemetrexed(2−) (CHEBI:63724) is conjugate base of pemetrexed (CHEBI:63616) |
| IUPAC Name |
|---|
| N-{4-[2-(2-amino-4-oxo-4,7-dihydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl}-L-glutamic acid |
| INN | Source |
|---|---|
| pemetrexed | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9097855 | Reaxys |
| CAS:137281-23-3 | ChemIDplus |
| CAS:137281-23-3 | KEGG DRUG |
| Citations |
|---|