EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N7O7 |
| Net Charge | 0 |
| Average Mass | 473.446 |
| Monoisotopic Mass | 473.16590 |
| SMILES | [H]C(=O)N1c2c(nc(N)nc2=O)NC[C@@H]1CNc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32)/t12-,13-/m0/s1 |
| InChIKey | VVIAGPKUTFNRDU-STQMWFEESA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6S)-5-formyltetrahydrofolic acid (CHEBI:63606) has role antineoplastic agent (CHEBI:35610) |
| (6S)-5-formyltetrahydrofolic acid (CHEBI:63606) has role metabolite (CHEBI:25212) |
| (6S)-5-formyltetrahydrofolic acid (CHEBI:63606) is a 5-formyltetrahydrofolic acid (CHEBI:15640) |
| (6S)-5-formyltetrahydrofolic acid (CHEBI:63606) is conjugate acid of (6S)-5-formyltetrahydrofolate(2−) (CHEBI:57457) |
| Incoming Relation(s) |
| (6S)-5-formyltetrahydrofolate(2−) (CHEBI:57457) is conjugate base of (6S)-5-formyltetrahydrofolic acid (CHEBI:63606) |
| IUPAC Name |
|---|
| N-[4-({[(6S)-2-amino-5-formyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid |
| Synonyms | Source |
|---|---|
| (6S)-5-Formyl-5,6,7,8-tetrahydrofolic acid | ChemIDplus |
| (6S)-Folinic acid | ChemIDplus |
| (6S)-Leucovorin | ChemIDplus |
| Citrovorum factor | ChemIDplus |
| N-[4-({[(6S)-2-amino-5-formyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl]methyl}amino)benzoyl]-L-glutamic acid | PDBeChem |
| Levofolene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:101690 | Reaxys |
| CAS:68538-85-2 | ChemIDplus |
| Citations |
|---|