EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24I3N3O8 |
| Net Charge | 0 |
| Average Mass | 791.115 |
| Monoisotopic Mass | 790.86976 |
| SMILES | COCC(=O)Nc1c(I)c(C(=O)NCC(O)CO)c(I)c(C(=O)N(C)CC(O)CO)c1I |
| InChI | InChI=1S/C18H24I3N3O8/c1-24(4-9(28)6-26)18(31)12-13(19)11(17(30)22-3-8(27)5-25)14(20)16(15(12)21)23-10(29)7-32-2/h8-9,25-28H,3-7H2,1-2H3,(H,22,30)(H,23,29) |
| InChIKey | DGAIEPBNLOQYER-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. |
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iopromide (CHEBI:63578) has functional parent glycerol (CHEBI:17754) |
| iopromide (CHEBI:63578) has functional parent isophthalamide (CHEBI:38801) |
| iopromide (CHEBI:63578) has role environmental contaminant (CHEBI:78298) |
| iopromide (CHEBI:63578) has role nephrotoxic agent (CHEBI:50909) |
| iopromide (CHEBI:63578) has role radioopaque medium (CHEBI:37338) |
| iopromide (CHEBI:63578) has role xenobiotic (CHEBI:35703) |
| iopromide (CHEBI:63578) is a dicarboxylic acid diamide (CHEBI:35779) |
| iopromide (CHEBI:63578) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| N,N'-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-[(methoxyacetyl)amino]-N-methylisophthalamide |
| INNs | Source |
|---|---|
| iopromida | ChemIDplus |
| iopromide | KEGG DRUG |
| iopromidum | ChemIDplus |
| Synonym | Source |
|---|---|
| N,N'-Bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-(2-methoxyacetamido)-N-methylisophthalamide | ChemIDplus |
| Brand Name | Source |
|---|---|
| Ultravist | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7085608 | Reaxys |
| CAS:73334-07-3 | ChemIDplus |
| Citations |
|---|