EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O5S |
| Net Charge | 0 |
| Average Mass | 462.652 |
| Monoisotopic Mass | 462.24400 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CSC(=O)C(C)(C)C)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C26H38O5S/c1-23(2,3)22(30)32-14-20(29)26(31)11-9-18-17-7-6-15-12-16(27)8-10-24(15,4)21(17)19(28)13-25(18,26)5/h12,17-19,21,28,31H,6-11,13-14H2,1-5H3/t17-,18-,19-,21+,24-,25-,26-/m0/s1 |
| InChIKey | BISFDZNIUZIKJD-XDANTLIUSA-N |
| Roles Classification |
|---|
| Biological Roles: | glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tixocortol pivalate (CHEBI:63564) has functional parent tixocortol (CHEBI:63560) |
| tixocortol pivalate (CHEBI:63564) has role allergen (CHEBI:50904) |
| tixocortol pivalate (CHEBI:63564) has role anti-allergic agent (CHEBI:50857) |
| tixocortol pivalate (CHEBI:63564) has role glucocorticoid receptor agonist (CHEBI:63562) |
| tixocortol pivalate (CHEBI:63564) has role nasal decongestant (CHEBI:77715) |
| tixocortol pivalate (CHEBI:63564) is a corticosteroid (CHEBI:50858) |
| tixocortol pivalate (CHEBI:63564) is a pivalate ester (CHEBI:50784) |
| tixocortol pivalate (CHEBI:63564) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| tixocortol pivalate (CHEBI:63564) is a thioester (CHEBI:51277) |
| IUPAC Name |
|---|
| S-(11β,17-dihydroxy-3,20-dioxopregn-4-en-21-yl) 2,2-dimethylpropanethioate |
| Synonyms | Source |
|---|---|
| (11β)-11,17-dihydroxy-21-((2,2-dimethyl-1-oxopropyl)thio)pregn-4-ene-3,20-dione | ChemIDplus |
| 11β,17-dihydroxy-21-mercaptopregn-4-ene-3,20-dione 21-pivalate | ChemIDplus |
| Cortisol 21-thiol | ChEMBL |
| JO-1016 | ChEMBL |
| Pivalone | ChemIDplus |
| Tixocortol 21-pivalate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6577822 | Reaxys |
| CAS:55560-96-8 | ChemIDplus |
| Citations |
|---|