EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O4S |
| Net Charge | 0 |
| Average Mass | 378.534 |
| Monoisotopic Mass | 378.18648 |
| SMILES | [H][C@@]12CC[C@](O)(C(=O)CS)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@@]21C |
| InChI | InChI=1S/C21H30O4S/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-26)20(15,2)10-16(23)18(14)19/h9,14-16,18,23,25-26H,3-8,10-11H2,1-2H3/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
| InChIKey | YWDBSCORAARPPF-VWUMJDOOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | glucocorticoid receptor agonist An agonist that selectively binds to and activates a glucocorticoid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tixocortol (CHEBI:63560) has parent hydride pregnane (CHEBI:8386) |
| tixocortol (CHEBI:63560) has role glucocorticoid receptor agonist (CHEBI:63562) |
| tixocortol (CHEBI:63560) is a 11β-hydroxy steroid (CHEBI:35346) |
| tixocortol (CHEBI:63560) is a 17α-hydroxy steroid (CHEBI:35342) |
| tixocortol (CHEBI:63560) is a 20-oxo steroid (CHEBI:36885) |
| tixocortol (CHEBI:63560) is a 3-oxo-Δ4 steroid (CHEBI:47909) |
| tixocortol (CHEBI:63560) is a steroid sulfide (CHEBI:62027) |
| tixocortol (CHEBI:63560) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| tixocortol pivalate (CHEBI:63564) has functional parent tixocortol (CHEBI:63560) |
| IUPAC Name |
|---|
| 11β,17-dihydroxy-21-sulfanylpregn-4-ene-3,20-dione |
| INNs | Source |
|---|---|
| tixocortolum | ChemIDplus |
| tixocortol | ChemIDplus |
| Synonym | Source |
|---|---|
| (11β)-11,17-dihydroxy-21-mercaptopregn-4-ene-3,20-dione | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Tixocortol | Wikipedia |
| D08610 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5356025 | Reaxys |
| CAS:61951-99-3 | ChemIDplus |
| Citations |
|---|