EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30N6OS |
| Net Charge | 0 |
| Average Mass | 498.656 |
| Monoisotopic Mass | 498.22018 |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CCN(C)CC3)cc2)cc1Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C28H30N6OS/c1-20-5-10-24(16-25(20)31-28-32-26(19-36-28)23-4-3-11-29-17-23)30-27(35)22-8-6-21(7-9-22)18-34-14-12-33(2)13-15-34/h3-11,16-17,19H,12-15,18H2,1-2H3,(H,30,35)(H,31,32) |
| InChIKey | WJEOLQLKVOPQFV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| masitinib (CHEBI:63450) has role antineoplastic agent (CHEBI:35610) |
| masitinib (CHEBI:63450) has role antirheumatic drug (CHEBI:35842) |
| masitinib (CHEBI:63450) has role tyrosine kinase inhibitor (CHEBI:38637) |
| masitinib (CHEBI:63450) is a N-alkylpiperazine (CHEBI:46845) |
| masitinib (CHEBI:63450) is a 1,3-thiazoles (CHEBI:38418) |
| masitinib (CHEBI:63450) is a benzamides (CHEBI:22702) |
| masitinib (CHEBI:63450) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 4-[(4-methylpiperazin-1-yl)methyl]-N-(4-methyl-3-{[4-(pyridin-3-yl)-1,3-thiazol-2-yl]amino}phenyl)benzamide |
| INN | Source |
|---|---|
| masitinib | ChemIDplus |
| Synonyms | Source |
|---|---|
| AB 1010 | ChemIDplus |
| AB-1010 | ChemIDplus |
| AB1010 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12083382 | Reaxys |
| CAS:790299-79-5 | ChemIDplus |
| Citations |
|---|